6-ethoxy-7H-purine
Catalog No: FT-0769564
CAS No: 17861-06-2
- Chemical Name: 6-ethoxy-7H-purine
- Molecular Formula: C7H8N4O
- Molecular Weight: 164.16
- InChI Key: BMLKPGJBYUTIHT-UHFFFAOYSA-N
- InChI: InChI=1S/C7H8N4O/c1-2-12-7-5-6(9-3-8-5)10-4-11-7/h3-4H,2H2,1H3,(H,8,9,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 17861-06-2 |
| Flash_Point: | 154.2ºC |
| Product_Name: | 6-ethoxy-7H-purine |
| Bolling_Point: | 427.6ºC at 760mmHg |
| FW: | 164.16500 |
| Melting_Point: | N/A |
| MF: | C7H8N4O |
| Density: | 1.345g/cm3 |
| FW: | 164.16500 |
|---|---|
| MF: | C7H8N4O |
| Exact_Mass: | 164.07000 |
| LogP: | 0.75160 |
| Bolling_Point: | 427.6ºC at 760mmHg |
| Density: | 1.345g/cm3 |
| PSA: | 63.69000 |
| Flash_Point: | 154.2ºC |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R22 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RTECS: | UO8530000 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn: Harmful; |
| HS_Code: | 2933990090 |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)